C14H22Cl3NO3 — CID 45101035
[(Z)-1-(2,2,2-trichloroethanimidoyl)oxydec-2-en-4-yl] acetate (PubChem CID 45101035) has the molecular formula C14H22Cl3NO3 and a molecular weight of 358.69 g/mol. Its IUPAC name is [(Z)-1-(2,2,2-trichloroethanimidoyl)oxydec-2-en-4-yl] acetate.
| Compound Name | [(Z)-1-(2,2,2-trichloroethanimidoyl)oxydec-2-en-4-yl] acetate |
|---|---|
| PubChem CID | 45101035 |
| Molecular Formula | C14H22Cl3NO3 |
| Molecular Weight | 358.69 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | [(Z)-1-(2,2,2-trichloroethanimidoyl)oxydec-2-en-4-yl] acetate |
| SMILES | [H]/N=C(\OC/C=C\C(CCCCCC)OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H22Cl3NO3/c1-3-4-5-6-8-12(21-11(2)19)9-7-10-20-13(18)14(15,16)17/h7,9,12,18H,3-6,8,10H2,1-2H3/b9-7-,18-13- |
| InChIKey | SCGLLQZSZCFTFV-OMIQRVFBSA-N |
| XLogP | 4.81 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|