C9H10Cl3NO3 — CID 25259234
[(1R,4S)-4-(2,2,2-trichloroethanimidoyl)oxycyclopent-2-en-1-yl] acetate (PubChem CID 25259234) has the molecular formula C9H10Cl3NO3 and a molecular weight of 286.54 g/mol. Its IUPAC name is [(1R,4S)-4-(2,2,2-trichloroethanimidoyl)oxycyclopent-2-en-1-yl] acetate.
| Compound Name | [(1R,4S)-4-(2,2,2-trichloroethanimidoyl)oxycyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 25259234 |
| Molecular Formula | C9H10Cl3NO3 |
| Molecular Weight | 286.54 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | [(1R,4S)-4-(2,2,2-trichloroethanimidoyl)oxycyclopent-2-en-1-yl] acetate |
| SMILES | [H]/N=C(/O[C@@H]1C=C[C@H](OC(C)=O)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H10Cl3NO3/c1-5(14)15-6-2-3-7(4-6)16-8(13)9(10,11)12/h2-3,6-7,13H,4H2,1H3/b13-8+/t6-,7+/m0/s1 |
| InChIKey | ZIWVYIUODBTPAJ-BOUSQZQKSA-N |
| XLogP | 2.61 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|