C10H14Cl3NO3 — CID 44623018
[(E)-2-methyl-5-(2,2,2-trichloroethanimidoyl)oxypent-3-en-2-yl] acetate (PubChem CID 44623018) has the molecular formula C10H14Cl3NO3 and a molecular weight of 302.59 g/mol. Its IUPAC name is [(E)-2-methyl-5-(2,2,2-trichloroethanimidoyl)oxypent-3-en-2-yl] acetate.
| Compound Name | [(E)-2-methyl-5-(2,2,2-trichloroethanimidoyl)oxypent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 44623018 |
| Molecular Formula | C10H14Cl3NO3 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | [(E)-2-methyl-5-(2,2,2-trichloroethanimidoyl)oxypent-3-en-2-yl] acetate |
| SMILES | [H]/N=C(/OC/C=C/C(C)(C)OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H14Cl3NO3/c1-7(15)17-9(2,3)5-4-6-16-8(14)10(11,12)13/h4-5,14H,6H2,1-3H3/b5-4+,14-8+ |
| InChIKey | OYRDJOHEQSNMOE-DLBFRJOTSA-N |
| XLogP | 3.25 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|