C8H10Cl3NO3 — CID 10540315
[(Z)-4-(2,2,2-trichloroethanimidoyl)oxybut-2-enyl] acetate (PubChem CID 10540315) has the molecular formula C8H10Cl3NO3 and a molecular weight of 274.53 g/mol. Its IUPAC name is [(Z)-4-(2,2,2-trichloroethanimidoyl)oxybut-2-enyl] acetate.
| Compound Name | [(Z)-4-(2,2,2-trichloroethanimidoyl)oxybut-2-enyl] acetate |
|---|---|
| PubChem CID | 10540315 |
| Molecular Formula | C8H10Cl3NO3 |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | [(Z)-4-(2,2,2-trichloroethanimidoyl)oxybut-2-enyl] acetate |
| SMILES | [H]/N=C(\OC/C=C\COC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H10Cl3NO3/c1-6(13)14-4-2-3-5-15-7(12)8(9,10)11/h2-3,12H,4-5H2,1H3/b3-2-,12-7- |
| InChIKey | LREWEVVBUGQBKB-KVQNYADJSA-N |
| XLogP | 2.47 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|