C8H12Cl3NO2 — CID 11459645
[(E,4S)-4-methoxypent-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 11459645) has the molecular formula C8H12Cl3NO2 and a molecular weight of 260.55 g/mol. Its IUPAC name is [(E,4S)-4-methoxypent-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E,4S)-4-methoxypent-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11459645 |
| Molecular Formula | C8H12Cl3NO2 |
| Molecular Weight | 260.55 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | [(E,4S)-4-methoxypent-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/[C@H](C)OC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H12Cl3NO2/c1-6(13-2)4-3-5-14-7(12)8(9,10)11/h3-4,6,12H,5H2,1-2H3/b4-3+,12-7-/t6-/m0/s1 |
| InChIKey | MKGQGOQNCILAAN-MYIWHGOYSA-N |
| XLogP | 2.94 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|