C12H18Cl3NO3 — CID 45101125
[(E)-2-methyl-7-(2,2,2-trichloroethanimidoyl)oxyhept-4-en-3-yl] acetate (PubChem CID 45101125) has the molecular formula C12H18Cl3NO3 and a molecular weight of 330.64 g/mol. Its IUPAC name is [(E)-2-methyl-7-(2,2,2-trichloroethanimidoyl)oxyhept-4-en-3-yl] acetate.
| Compound Name | [(E)-2-methyl-7-(2,2,2-trichloroethanimidoyl)oxyhept-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 45101125 |
| Molecular Formula | C12H18Cl3NO3 |
| Molecular Weight | 330.64 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | [(E)-2-methyl-7-(2,2,2-trichloroethanimidoyl)oxyhept-4-en-3-yl] acetate |
| SMILES | [H]/N=C(\OCC/C=C/C(OC(C)=O)C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H18Cl3NO3/c1-8(2)10(19-9(3)17)6-4-5-7-18-11(16)12(13,14)15/h4,6,8,10,16H,5,7H2,1-3H3/b6-4+,16-11- |
| InChIKey | QJSSSMNOHUKNOH-BTWLMBDHSA-N |
| XLogP | 3.88 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.64 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|