C11H16Cl3NO3 — CID 45101823
[(Z,3S)-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyhex-4-en-3-yl] acetate (PubChem CID 45101823) has the molecular formula C11H16Cl3NO3 and a molecular weight of 316.61 g/mol. Its IUPAC name is [(Z,3S)-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyhex-4-en-3-yl] acetate.
| Compound Name | [(Z,3S)-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyhex-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 45101823 |
| Molecular Formula | C11H16Cl3NO3 |
| Molecular Weight | 316.61 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | [(Z,3S)-2-methyl-6-(2,2,2-trichloroethanimidoyl)oxyhex-4-en-3-yl] acetate |
| SMILES | [H]/N=C(\OC/C=C\[C@@H](OC(C)=O)C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H16Cl3NO3/c1-7(2)9(18-8(3)16)5-4-6-17-10(15)11(12,13)14/h4-5,7,9,15H,6H2,1-3H3/b5-4-,15-10-/t9-/m1/s1 |
| InChIKey | DPYYWJZFWIHCBX-WRVNWWOQSA-N |
| XLogP | 3.49 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|