C17H30Cl3NO3 — CID 15384821
[(Z,4R,5S)-4-(methoxymethoxymethyl)-2,9-dimethyldec-6-en-5-yl] 2,2,2-trichloroethanimidate (PubChem CID 15384821) has the molecular formula C17H30Cl3NO3 and a molecular weight of 402.79 g/mol. Its IUPAC name is [(Z,4R,5S)-4-(methoxymethoxymethyl)-2,9-dimethyldec-6-en-5-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(Z,4R,5S)-4-(methoxymethoxymethyl)-2,9-dimethyldec-6-en-5-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 15384821 |
| Molecular Formula | C17H30Cl3NO3 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [(Z,4R,5S)-4-(methoxymethoxymethyl)-2,9-dimethyldec-6-en-5-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H](/C=C\CC(C)C)[C@@H](COCOC)CC(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H30Cl3NO3/c1-12(2)7-6-8-15(24-16(21)17(18,19)20)14(9-13(3)4)10-23-11-22-5/h6,8,12-15,21H,7,9-11H2,1-5H3/b8-6-,21-16+/t14-,15+/m1/s1 |
| InChIKey | QYHOSWAUGGPFJL-XJLXXIEJSA-N |
| XLogP | 5.60 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|