C14H24Cl3NO3 — CID 15384815
[(Z,2R,3S)-1-(methoxymethoxy)-2-methylnon-4-en-3-yl] 2,2,2-trichloroethanimidate (PubChem CID 15384815) has the molecular formula C14H24Cl3NO3 and a molecular weight of 360.71 g/mol. Its IUPAC name is [(Z,2R,3S)-1-(methoxymethoxy)-2-methylnon-4-en-3-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(Z,2R,3S)-1-(methoxymethoxy)-2-methylnon-4-en-3-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 15384815 |
| Molecular Formula | C14H24Cl3NO3 |
| Molecular Weight | 360.71 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | [(Z,2R,3S)-1-(methoxymethoxy)-2-methylnon-4-en-3-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H](/C=C\CCCC)[C@H](C)COCOC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H24Cl3NO3/c1-4-5-6-7-8-12(11(2)9-20-10-19-3)21-13(18)14(15,16)17/h7-8,11-12,18H,4-6,9-10H2,1-3H3/b8-7-,18-13+/t11-,12+/m1/s1 |
| InChIKey | MGVQJDDVPGAVJG-CFJAKQDFSA-N |
| XLogP | 4.72 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|