C16H28Cl3NO3 — CID 11090391
[(Z,3R,4S)-3-(methoxymethoxymethyl)-2-methyldec-5-en-4-yl] 2,2,2-trichloroethanimidate (PubChem CID 11090391) has the molecular formula C16H28Cl3NO3 and a molecular weight of 388.76 g/mol. Its IUPAC name is [(Z,3R,4S)-3-(methoxymethoxymethyl)-2-methyldec-5-en-4-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(Z,3R,4S)-3-(methoxymethoxymethyl)-2-methyldec-5-en-4-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11090391 |
| Molecular Formula | C16H28Cl3NO3 |
| Molecular Weight | 388.76 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [(Z,3R,4S)-3-(methoxymethoxymethyl)-2-methyldec-5-en-4-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H](/C=C\CCCC)[C@@H](COCOC)C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H28Cl3NO3/c1-5-6-7-8-9-14(23-15(20)16(17,18)19)13(12(2)3)10-22-11-21-4/h8-9,12-14,20H,5-7,10-11H2,1-4H3/b9-8-,20-15+/t13-,14-/m0/s1 |
| InChIKey | LCTGICOSHHQETF-LOUYKQPMSA-N |
| XLogP | 5.36 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.76 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|