C16H28Cl3NO3 — CID 134870602
[(E,3S,4S)-3-(methoxymethoxy)-2,6-dimethyldec-5-en-4-yl] 2,2,2-trichloroethanimidate (PubChem CID 134870602) has the molecular formula C16H28Cl3NO3 and a molecular weight of 388.76 g/mol. Its IUPAC name is [(E,3S,4S)-3-(methoxymethoxy)-2,6-dimethyldec-5-en-4-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E,3S,4S)-3-(methoxymethoxy)-2,6-dimethyldec-5-en-4-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 134870602 |
| Molecular Formula | C16H28Cl3NO3 |
| Molecular Weight | 388.76 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [(E,3S,4S)-3-(methoxymethoxy)-2,6-dimethyldec-5-en-4-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H](/C=C(\C)CCCC)[C@@H](OCOC)C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H28Cl3NO3/c1-6-7-8-12(4)9-13(23-15(20)16(17,18)19)14(11(2)3)22-10-21-5/h9,11,13-14,20H,6-8,10H2,1-5H3/b12-9+,20-15+/t13-,14-/m0/s1 |
| InChIKey | MJLQLZPGQXZNFI-RAGDMQNJSA-N |
| XLogP | 5.50 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.76 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|