C12H20Cl3NO3 — CID 11695668
[(E,4S)-4-(methoxymethoxy)-6-methylhept-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 11695668) has the molecular formula C12H20Cl3NO3 and a molecular weight of 332.66 g/mol. Its IUPAC name is [(E,4S)-4-(methoxymethoxy)-6-methylhept-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E,4S)-4-(methoxymethoxy)-6-methylhept-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11695668 |
| Molecular Formula | C12H20Cl3NO3 |
| Molecular Weight | 332.66 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | [(E,4S)-4-(methoxymethoxy)-6-methylhept-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/[C@H](CC(C)C)OCOC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H20Cl3NO3/c1-9(2)7-10(19-8-17-3)5-4-6-18-11(16)12(13,14)15/h4-5,9-10,16H,6-8H2,1-3H3/b5-4+,16-11-/t10-/m1/s1 |
| InChIKey | RKMSRMRCRIHTSM-MGTHTFOPSA-N |
| XLogP | 3.94 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.66 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|