C16H22Cl3NO3 — CID 101096419
[(2E)-2-[(6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylcyclohex-3-en-1-ylidene]ethyl] 2,2,2-trichloroethanimidate (PubChem CID 101096419) has the molecular formula C16H22Cl3NO3 and a molecular weight of 382.72 g/mol. Its IUPAC name is [(2E)-2-[(6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylcyclohex-3-en-1-ylidene]ethyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2E)-2-[(6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylcyclohex-3-en-1-ylidene]ethyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 101096419 |
| Molecular Formula | C16H22Cl3NO3 |
| Molecular Weight | 382.72 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | [(2E)-2-[(6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylcyclohex-3-en-1-ylidene]ethyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C1\CC=C(C)C[C@@H]1[C@H]1COC(C)(C)O1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H22Cl3NO3/c1-10-4-5-11(6-7-21-14(20)16(17,18)19)12(8-10)13-9-22-15(2,3)23-13/h4,6,12-13,20H,5,7-9H2,1-3H3/b11-6+,20-14+/t12-,13+/m0/s1 |
| InChIKey | WIFSHSJAZFTBRS-HKWKCSFTSA-N |
| XLogP | 4.78 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|