C22H36Cl3NO4Si — CID 10839493
[(2E)-2-[(2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylcyclohex-3-en-1-ylidene]ethyl] 2,2,2-trichloroethanimidate (PubChem CID 10839493) has the molecular formula C22H36Cl3NO4Si and a molecular weight of 512.98 g/mol. Its IUPAC name is [(2E)-2-[(2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylcyclohex-3-en-1-ylidene]ethyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2E)-2-[(2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylcyclohex-3-en-1-ylidene]ethyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 10839493 |
| Molecular Formula | C22H36Cl3NO4Si |
| Molecular Weight | 512.98 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | [(2E)-2-[(2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylcyclohex-3-en-1-ylidene]ethyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C1/[C@@H](O[Si](C)(C)C(C)(C)C)C=C(C)C[C@@H]1[C@H]1COC(C)(C)O1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C22H36Cl3NO4Si/c1-14-11-16(18-13-28-21(5,6)29-18)15(9-10-27-19(26)22(23,24)25)17(12-14)30-31(7,8)20(2,3)4/h9,12,16-18,26H,10-11,13H2,1-8H3/b15-9+,26-19+/t16-,17-,18+/m0/s1 |
| InChIKey | ZUJJMUKEPMEQER-HTAPYUHLSA-N |
| XLogP | 6.78 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.98 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|