C14H18Cl3NO3 — CID 25128842
[(3aR,5R,7aS)-spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl] 2,2,2-trichloroethanimidate (PubChem CID 25128842) has the molecular formula C14H18Cl3NO3 and a molecular weight of 354.66 g/mol. Its IUPAC name is [(3aR,5R,7aS)-spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3aR,5R,7aS)-spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 25128842 |
| Molecular Formula | C14H18Cl3NO3 |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | [(3aR,5R,7aS)-spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1C=C[C@@H]2OC3(CCCCC3)O[C@@H]2C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H18Cl3NO3/c15-14(16,17)12(18)19-9-4-5-10-11(8-9)21-13(20-10)6-2-1-3-7-13/h4-5,9-11,18H,1-3,6-8H2/b18-12+/t9-,10-,11+/m0/s1 |
| InChIKey | QMELWSJDZNWECE-FRGHYGGSSA-N |
| XLogP | 4.12 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|