C19H30Cl3NO3S — CID 10950588
[(3aR,4R,6aS)-2,2-dipentyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] (1E)-2,2,2-trichloro-N-methylsulfanylethanimidate (PubChem CID 10950588) has the molecular formula C19H30Cl3NO3S and a molecular weight of 458.88 g/mol. Its IUPAC name is [(3aR,4R,6aS)-2,2-dipentyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] (1E)-2,2,2-trichloro-N-methylsulfanylethanimidate.
| Compound Name | [(3aR,4R,6aS)-2,2-dipentyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] (1E)-2,2,2-trichloro-N-methylsulfanylethanimidate |
|---|---|
| PubChem CID | 10950588 |
| Molecular Formula | C19H30Cl3NO3S |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | [(3aR,4R,6aS)-2,2-dipentyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] (1E)-2,2,2-trichloro-N-methylsulfanylethanimidate |
| SMILES | CCCCCC1(CCCCC)O[C@H]2[C@H](C=C[C@H]2O/C(=N/SC)C(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/C19H30Cl3NO3S/c1-4-6-8-12-18(13-9-7-5-2)25-15-11-10-14(16(15)26-18)24-17(23-27-3)19(20,21)22/h10-11,14-16H,4-9,12-13H2,1-3H3/b23-17+/t14-,15+,16-/m1/s1 |
| InChIKey | LMFKHZYCQKZERY-RCPOULGRSA-N |
| XLogP | 6.63 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|