C11H18Cl3NO4 — CID 11186688
[(E,4S)-4-(2-methoxyethoxymethoxy)pent-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 11186688) has the molecular formula C11H18Cl3NO4 and a molecular weight of 334.63 g/mol. Its IUPAC name is [(E,4S)-4-(2-methoxyethoxymethoxy)pent-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E,4S)-4-(2-methoxyethoxymethoxy)pent-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11186688 |
| Molecular Formula | C11H18Cl3NO4 |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | [(E,4S)-4-(2-methoxyethoxymethoxy)pent-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/[C@H](C)OCOCCOC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl3NO4/c1-9(19-8-17-7-6-16-2)4-3-5-18-10(15)11(12,13)14/h3-4,9,15H,5-8H2,1-2H3/b4-3+,15-10-/t9-/m0/s1 |
| InChIKey | DPCAWZCLUSDEIM-MFAOXKOESA-N |
| XLogP | 2.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|