C9H12Cl3NO3 — CID 11011679
[(2S,3S,6R)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-yl] 2,2,2-trichloroethanimidate (PubChem CID 11011679) has the molecular formula C9H12Cl3NO3 and a molecular weight of 288.56 g/mol. Its IUPAC name is [(2S,3S,6R)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2S,3S,6R)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11011679 |
| Molecular Formula | C9H12Cl3NO3 |
| Molecular Weight | 288.56 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | [(2S,3S,6R)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@H]1C=C[C@H](OC)O[C@H]1C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H12Cl3NO3/c1-5-6(3-4-7(14-2)15-5)16-8(13)9(10,11)12/h3-7,13H,1-2H3/b13-8+/t5-,6-,7+/m0/s1 |
| InChIKey | LQIKIZJSYJBKON-KQAOXFJXSA-N |
| XLogP | 2.67 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|