C10H12Cl3NO4 — CID 123658172
[(6R)-2-(2,2,2-trichloroethanimidoyl)oxy-3,6-dihydro-2H-pyran-6-yl]methyl acetate (PubChem CID 123658172) has the molecular formula C10H12Cl3NO4 and a molecular weight of 316.57 g/mol. Its IUPAC name is [(6R)-2-(2,2,2-trichloroethanimidoyl)oxy-3,6-dihydro-2H-pyran-6-yl]methyl acetate.
| Compound Name | [(6R)-2-(2,2,2-trichloroethanimidoyl)oxy-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
|---|---|
| PubChem CID | 123658172 |
| Molecular Formula | C10H12Cl3NO4 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | [(6R)-2-(2,2,2-trichloroethanimidoyl)oxy-3,6-dihydro-2H-pyran-6-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1CC=C[C@H](COC(C)=O)O1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3NO4/c1-6(15)16-5-7-3-2-4-8(17-7)18-9(14)10(11,12)13/h2-3,7-8,14H,4-5H2,1H3/b14-9+/t7-,8?/m1/s1 |
| InChIKey | RVWYIBSWLAVNJO-BRMRORAZSA-N |
| XLogP | 2.58 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|