C8H8Cl3NO3 — CID 46217287
[(2R,3R)-2-methyl-6-oxo-2,3-dihydropyran-3-yl] 2,2,2-trichloroethanimidate (PubChem CID 46217287) has the molecular formula C8H8Cl3NO3 and a molecular weight of 272.52 g/mol. Its IUPAC name is [(2R,3R)-2-methyl-6-oxo-2,3-dihydropyran-3-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2R,3R)-2-methyl-6-oxo-2,3-dihydropyran-3-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 46217287 |
| Molecular Formula | C8H8Cl3NO3 |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | [(2R,3R)-2-methyl-6-oxo-2,3-dihydropyran-3-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H]1C=CC(=O)O[C@@H]1C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H8Cl3NO3/c1-4-5(2-3-6(13)14-4)15-7(12)8(9,10)11/h2-5,12H,1H3/b12-7+/t4-,5-/m1/s1 |
| InChIKey | SXEMCSZZFIWIII-GUPWSHEDSA-N |
| XLogP | 2.22 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|