C7H8Cl3NO2 — CID 123177867
3,6-dihydro-2H-pyran-2-yl 2,2,2-trichloroethanimidate (PubChem CID 123177867) has the molecular formula C7H8Cl3NO2 and a molecular weight of 244.50 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyran-2-yl 2,2,2-trichloroethanimidate.
| Compound Name | 3,6-dihydro-2H-pyran-2-yl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 123177867 |
| Molecular Formula | C7H8Cl3NO2 |
| Molecular Weight | 244.50 g/mol |
| Exact Mass | 242.96 |
| IUPAC Name | 3,6-dihydro-2H-pyran-2-yl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1CC=CCO1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H8Cl3NO2/c8-7(9,10)6(11)13-5-3-1-2-4-12-5/h1-2,5,11H,3-4H2/b11-6+ |
| InChIKey | INDBHIFTHNQAPS-IZZDOVSWSA-N |
| XLogP | 2.65 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|