C11H16Cl3NO3 — CID 102297136
[(2E,4R)-4-(methoxymethoxy)hepta-2,6-dienyl] 2,2,2-trichloroethanimidate (PubChem CID 102297136) has the molecular formula C11H16Cl3NO3 and a molecular weight of 316.61 g/mol. Its IUPAC name is [(2E,4R)-4-(methoxymethoxy)hepta-2,6-dienyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2E,4R)-4-(methoxymethoxy)hepta-2,6-dienyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102297136 |
| Molecular Formula | C11H16Cl3NO3 |
| Molecular Weight | 316.61 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | [(2E,4R)-4-(methoxymethoxy)hepta-2,6-dienyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C/[C@@H](CC=C)OCOC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H16Cl3NO3/c1-3-5-9(18-8-16-2)6-4-7-17-10(15)11(12,13)14/h3-4,6,9,15H,1,5,7-8H2,2H3/b6-4+,15-10-/t9-/m1/s1 |
| InChIKey | HEOJIQPLCIXYRG-AZMZDBCJSA-N |
| XLogP | 3.47 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|