C15H20Cl6N2O4 — CID 11145581
[(Z,3S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2,2,2-trichloroethanimidoyl)oxyhex-4-enyl] 2,2,2-trichloroethanimidate (PubChem CID 11145581) has the molecular formula C15H20Cl6N2O4 and a molecular weight of 505.05 g/mol. Its IUPAC name is [(Z,3S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2,2,2-trichloroethanimidoyl)oxyhex-4-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(Z,3S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2,2,2-trichloroethanimidoyl)oxyhex-4-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11145581 |
| Molecular Formula | C15H20Cl6N2O4 |
| Molecular Weight | 505.05 g/mol |
| Exact Mass | 501.96 |
| IUPAC Name | [(Z,3S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(2,2,2-trichloroethanimidoyl)oxyhex-4-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OCC[C@@H](/C=C\C[C@H]1COC(C)(C)O1)O/C(=N/[H])C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H20Cl6N2O4/c1-13(2)25-8-10(27-13)5-3-4-9(26-12(23)15(19,20)21)6-7-24-11(22)14(16,17)18/h3-4,9-10,22-23H,5-8H2,1-2H3/b4-3-,22-11+,23-12+/t9-,10+/m1/s1 |
| InChIKey | BWODZWZWOZQBRL-CIDRYJTCSA-N |
| XLogP | 5.57 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.05 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|