C10H14Cl3NO3 — CID 102577344
[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 102577344) has the molecular formula C10H14Cl3NO3 and a molecular weight of 302.59 g/mol. Its IUPAC name is [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102577344 |
| Molecular Formula | C10H14Cl3NO3 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | [(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C/[C@H]1COC(C)(C)O1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H14Cl3NO3/c1-9(2)16-6-7(17-9)4-3-5-15-8(14)10(11,12)13/h3-4,7,14H,5-6H2,1-2H3/b4-3+,14-8+/t7-/m0/s1 |
| InChIKey | KSLGBIHFGFYKOZ-RFBXIDPUSA-N |
| XLogP | 3.06 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|