C14H24O7 — CID 10590599
(1R,3S,4S,7R,8S,10R)-1,10-dimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecane-6,7-diol (PubChem CID 10590599) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is (1R,3S,4S,7R,8S,10R)-1,10-dimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecane-6,7-diol.
| Compound Name | (1R,3S,4S,7R,8S,10R)-1,10-dimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecane-6,7-diol |
|---|---|
| PubChem CID | 10590599 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1R,3S,4S,7R,8S,10R)-1,10-dimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecane-6,7-diol |
| SMILES | CO[C@@]12CCCC[C@@]1(OC)O[C@@H]1[C@@H](O2)[C@H](C)OC(O)[C@@H]1O |
| InChI | InChI=1S/C14H24O7/c1-8-10-11(9(15)12(16)19-8)21-14(18-3)7-5-4-6-13(14,17-2)20-10/h8-12,15-16H,4-7H2,1-3H3/t8-,9+,10-,11-,12?,13+,14+/m0/s1 |
| InChIKey | JNWMSDKERGZHCT-RMDSETHASA-N |
| XLogP | 0.13 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |