C16H28O6S — CID 10783947
(1S,3S,4S,6S,7R,8S,10S)-6-ethylsulfanyl-1,10-dimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol (PubChem CID 10783947) has the molecular formula C16H28O6S and a molecular weight of 348.46 g/mol. Its IUPAC name is (1S,3S,4S,6S,7R,8S,10S)-6-ethylsulfanyl-1,10-dimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol.
| Compound Name | (1S,3S,4S,6S,7R,8S,10S)-6-ethylsulfanyl-1,10-dimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol |
|---|---|
| PubChem CID | 10783947 |
| Molecular Formula | C16H28O6S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (1S,3S,4S,6S,7R,8S,10S)-6-ethylsulfanyl-1,10-dimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol |
| SMILES | CCS[C@@H]1O[C@@H](C)[C@@H]2O[C@@]3(OC)CCCC[C@]3(OC)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C16H28O6S/c1-5-23-14-11(17)13-12(10(2)20-14)21-15(18-3)8-6-7-9-16(15,19-4)22-13/h10-14,17H,5-9H2,1-4H3/t10-,11+,12-,13-,14-,15-,16-/m0/s1 |
| InChIKey | CLTHSJMFEJLOIH-DWTGPMEZSA-N |
| XLogP | 1.89 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |