C15H26O7 — CID 10519586
(1S,3R,4R,6S,7S,8R,10S)-1,6,10-trimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol (PubChem CID 10519586) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is (1S,3R,4R,6S,7S,8R,10S)-1,6,10-trimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol.
| Compound Name | (1S,3R,4R,6S,7S,8R,10S)-1,6,10-trimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol |
|---|---|
| PubChem CID | 10519586 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (1S,3R,4R,6S,7S,8R,10S)-1,6,10-trimethoxy-4-methyl-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol |
| SMILES | CO[C@H]1O[C@H](C)[C@H]2O[C@@]3(OC)CCCC[C@]3(OC)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C15H26O7/c1-9-11-12(10(16)13(17-2)20-9)22-15(19-4)8-6-5-7-14(15,18-3)21-11/h9-13,16H,5-8H2,1-4H3/t9-,10+,11-,12-,13+,14+,15+/m1/s1 |
| InChIKey | PPGMYUJZUMCDLA-NNEGLZRWSA-N |
| XLogP | 0.78 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |