C18H30O8 — CID 12016259
(3aR,4R,4aS,10aS,11S,11aS)-4,5a,9a-trimethoxy-2,2-dimethyl-3a,4,4a,6,7,8,9,10a,11,11a-decahydro-[1,3]dioxolo[4,5-b]oxanthren-11-ol (PubChem CID 12016259) has the molecular formula C18H30O8 and a molecular weight of 374.43 g/mol. Its IUPAC name is (3aR,4R,4aS,10aS,11S,11aS)-4,5a,9a-trimethoxy-2,2-dimethyl-3a,4,4a,6,7,8,9,10a,11,11a-decahydro-[1,3]dioxolo[4,5-b]oxanthren-11-ol.
| Compound Name | (3aR,4R,4aS,10aS,11S,11aS)-4,5a,9a-trimethoxy-2,2-dimethyl-3a,4,4a,6,7,8,9,10a,11,11a-decahydro-[1,3]dioxolo[4,5-b]oxanthren-11-ol |
|---|---|
| PubChem CID | 12016259 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (3aR,4R,4aS,10aS,11S,11aS)-4,5a,9a-trimethoxy-2,2-dimethyl-3a,4,4a,6,7,8,9,10a,11,11a-decahydro-[1,3]dioxolo[4,5-b]oxanthren-11-ol |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](O)[C@@H]2OC3(OC)CCCCC3(OC)O[C@@H]12 |
| InChI | InChI=1S/C18H30O8/c1-16(2)23-11-10(19)12-15(13(20-3)14(11)24-16)26-18(22-5)9-7-6-8-17(18,21-4)25-12/h10-15,19H,6-9H2,1-5H3/t10-,11-,12-,13+,14-,15+,17?,18?/m0/s1 |
| InChIKey | RXYRKYDATZLQLW-AUCWCIOJSA-N |
| XLogP | 0.94 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |