C21H30O7 — CID 162408764
(1R,3S,4S,6R,7R,8S,10S)-1,10-dimethoxy-4-methyl-6-phenylmethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol (PubChem CID 162408764) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is (1R,3S,4S,6R,7R,8S,10S)-1,10-dimethoxy-4-methyl-6-phenylmethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol.
| Compound Name | (1R,3S,4S,6R,7R,8S,10S)-1,10-dimethoxy-4-methyl-6-phenylmethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol |
|---|---|
| PubChem CID | 162408764 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (1R,3S,4S,6R,7R,8S,10S)-1,10-dimethoxy-4-methyl-6-phenylmethoxy-2,5,9-trioxatricyclo[8.4.0.03,8]tetradecan-7-ol |
| SMILES | CO[C@]12CCCC[C@@]1(OC)O[C@@H]1[C@@H](O2)[C@@H](O)[C@H](OCc2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C21H30O7/c1-14-17-18(16(22)19(26-14)25-13-15-9-5-4-6-10-15)28-21(24-3)12-8-7-11-20(21,23-2)27-17/h4-6,9-10,14,16-19,22H,7-8,11-13H2,1-3H3/t14-,16+,17-,18-,19+,20+,21-/m0/s1 |
| InChIKey | YMSSBQLSIKQPGA-GUKHHJRNSA-N |
| XLogP | 2.35 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |