C13H24O5 — CID 143930160
(3aS,4R,6S,7R,7aS)-6,7-diethoxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol (PubChem CID 143930160) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is (3aS,4R,6S,7R,7aS)-6,7-diethoxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4R,6S,7R,7aS)-6,7-diethoxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 143930160 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (3aS,4R,6S,7R,7aS)-6,7-diethoxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-ol |
| SMILES | CCO[C@H]1[C@@H]2OC(C)(C)O[C@H]2[C@H](O)C[C@@H]1OCC |
| InChI | InChI=1S/C13H24O5/c1-5-15-9-7-8(14)10-12(11(9)16-6-2)18-13(3,4)17-10/h8-12,14H,5-7H2,1-4H3/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | ARPBOUNWPREJKD-YBXAARCKSA-N |
| XLogP | 1.08 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |