C13H20O5 — CID 10967094
[(3aR,4S,7R,7aS)-7-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] butanoate (PubChem CID 10967094) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is [(3aR,4S,7R,7aS)-7-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] butanoate.
| Compound Name | [(3aR,4S,7R,7aS)-7-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] butanoate |
|---|---|
| PubChem CID | 10967094 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [(3aR,4S,7R,7aS)-7-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C=C[C@@H](O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C13H20O5/c1-4-5-10(15)16-9-7-6-8(14)11-12(9)18-13(2,3)17-11/h6-9,11-12,14H,4-5H2,1-3H3/t8-,9+,11+,12-/m1/s1 |
| InChIKey | ZOLUOFGHSCWTDR-LLHIFLOGSA-N |
| XLogP | 1.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|