C10H14O5 — CID 130245409
[(6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] methyl carbonate (PubChem CID 130245409) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is [(6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] methyl carbonate.
| Compound Name | [(6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] methyl carbonate |
|---|---|
| PubChem CID | 130245409 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | [(6aS)-2,2-dimethyl-4,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-4-yl] methyl carbonate |
| SMILES | COC(=O)OC1C=C[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C10H14O5/c1-10(2)14-7-5-4-6(8(7)15-10)13-9(11)12-3/h4-8H,1-3H3/t6?,7-,8?/m0/s1 |
| InChIKey | UQIJNIAYOZGQCV-WTIBDHCWSA-N |
| XLogP | 1.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|