C11H15NO4 — CID 10857121
methyl (3aS,5aS,6aS,6bR)-2,2-dimethyl-3a,5a,6a,6b-tetrahydro-[1,3]benzodioxolo[6,7-b]azirine-6-carboxylate (PubChem CID 10857121) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is methyl (3aS,5aS,6aS,6bR)-2,2-dimethyl-3a,5a,6a,6b-tetrahydro-[1,3]benzodioxolo[6,7-b]azirine-6-carboxylate.
| Compound Name | methyl (3aS,5aS,6aS,6bR)-2,2-dimethyl-3a,5a,6a,6b-tetrahydro-[1,3]benzodioxolo[6,7-b]azirine-6-carboxylate |
|---|---|
| PubChem CID | 10857121 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methyl (3aS,5aS,6aS,6bR)-2,2-dimethyl-3a,5a,6a,6b-tetrahydro-[1,3]benzodioxolo[6,7-b]azirine-6-carboxylate |
| SMILES | COC(=O)N1[C@@H]2[C@H]3OC(C)(C)O[C@H]3C=C[C@@H]21 |
| InChI | InChI=1S/C11H15NO4/c1-11(2)15-7-5-4-6-8(9(7)16-11)12(6)10(13)14-3/h4-9H,1-3H3/t6-,7-,8-,9-,12?/m0/s1 |
| InChIKey | LAXPEVGTNOJRBY-CZDMUPAQSA-N |
| XLogP | 0.90 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|