C11H13Br2NO5 — CID 10905412
methyl (1S,2R,6R,7R)-7,10-dibromo-4,4-dimethyl-3,5,8-trioxa-9-azatricyclo[5.2.2.02,6]undec-10-ene-9-carboxylate (PubChem CID 10905412) has the molecular formula C11H13Br2NO5 and a molecular weight of 399.04 g/mol. Its IUPAC name is methyl (1S,2R,6R,7R)-7,10-dibromo-4,4-dimethyl-3,5,8-trioxa-9-azatricyclo[5.2.2.02,6]undec-10-ene-9-carboxylate.
| Compound Name | methyl (1S,2R,6R,7R)-7,10-dibromo-4,4-dimethyl-3,5,8-trioxa-9-azatricyclo[5.2.2.02,6]undec-10-ene-9-carboxylate |
|---|---|
| PubChem CID | 10905412 |
| Molecular Formula | C11H13Br2NO5 |
| Molecular Weight | 399.04 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | methyl (1S,2R,6R,7R)-7,10-dibromo-4,4-dimethyl-3,5,8-trioxa-9-azatricyclo[5.2.2.02,6]undec-10-ene-9-carboxylate |
| SMILES | COC(=O)N1O[C@@]2(Br)C=C(Br)[C@@H]1[C@H]1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C11H13Br2NO5/c1-10(2)17-7-6-5(12)4-11(13,8(7)18-10)19-14(6)9(15)16-3/h4,6-8H,1-3H3/t6-,7-,8-,11+/m1/s1 |
| InChIKey | CDGBOBQDMDSRPB-NKIIXMILSA-N |
| XLogP | 2.27 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.04 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|