C14H22O4 — CID 11128866
methyl 3-[(1R,2S,6R,7R,8R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl]propanoate (PubChem CID 11128866) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 3-[(1R,2S,6R,7R,8R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl]propanoate.
| Compound Name | methyl 3-[(1R,2S,6R,7R,8R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl]propanoate |
|---|---|
| PubChem CID | 11128866 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | methyl 3-[(1R,2S,6R,7R,8R)-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-8-yl]propanoate |
| SMILES | COC(=O)CC[C@@H]1C[C@@H]2C[C@H]1[C@H]1OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C14H22O4/c1-14(2)17-12-9-6-8(4-5-11(15)16-3)10(7-9)13(12)18-14/h8-10,12-13H,4-7H2,1-3H3/t8-,9-,10-,12+,13-/m1/s1 |
| InChIKey | WZANLEODIABPPD-HQPVMZNJSA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |