C62H112N8O5 — CID 173497830
5,14,23,32-tetrakis(2,4-dimethylpentan-3-yloxy)-34-methyl-2,11,20,29,38,39,40,41-octazanonacyclo[28.7.1.13,10.112,19.121,28.04,9.013,18.022,27.031,37]hentetraconta-32,35-dien-34-ol (PubChem CID 173497830) has the molecular formula C62H112N8O5 and a molecular weight of 1049.63 g/mol. Its IUPAC name is 5,14,23,32-tetrakis(2,4-dimethylpentan-3-yloxy)-34-methyl-2,11,20,29,38,39,40,41-octazanonacyclo[28.7.1.13,10.112,19.121,28.04,9.013,18.022,27.031,37]hentetraconta-32,35-dien-34-ol.
| Compound Name | 5,14,23,32-tetrakis(2,4-dimethylpentan-3-yloxy)-34-methyl-2,11,20,29,38,39,40,41-octazanonacyclo[28.7.1.13,10.112,19.121,28.04,9.013,18.022,27.031,37]hentetraconta-32,35-dien-34-ol |
|---|---|
| PubChem CID | 173497830 |
| Molecular Formula | C62H112N8O5 |
| Molecular Weight | 1049.63 g/mol |
| Exact Mass | 1048.88 |
| IUPAC Name | 5,14,23,32-tetrakis(2,4-dimethylpentan-3-yloxy)-34-methyl-2,11,20,29,38,39,40,41-octazanonacyclo[28.7.1.13,10.112,19.121,28.04,9.013,18.022,27.031,37]hentetraconta-32,35-dien-34-ol |
| SMILES | CC(C)C(OC1=CC(C)(O)C=CC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3C(OC(C(C)C)C(C)C)CCCC63)C3C(OC(C(C)C)C(C)C)CCCC53)C3C(OC(C(C)C)C(C)C)CCCC43)C12)C(C)C |
| InChI | InChI=1S/C62H112N8O5/c1-30(2)50(31(3)4)72-42-24-18-21-38-46(42)58-63-54(38)64-59-47-40(23-20-25-43(47)73-51(32(5)6)33(7)8)56(67-59)68-61-49-41(27-28-62(17,71)29-45(49)75-53(36(13)14)37(15)16)57(70-61)69-60-48-39(55(65-58)66-60)22-19-26-44(48)74-52(34(9)10)35(11)12/h27-44,46-61,63-71H,18-26H2,1-17H3 |
| InChIKey | LMAOELRDHJCTLA-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 153.39 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 75 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.63 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|