C15H22F4O2 — CID 89136997
2-[[5-(1,1,2,2-tetrafluoropropyl)-2-bicyclo[2.2.1]heptanyl]oxy]oxane (PubChem CID 89136997) has the molecular formula C15H22F4O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-[[5-(1,1,2,2-tetrafluoropropyl)-2-bicyclo[2.2.1]heptanyl]oxy]oxane.
| Compound Name | 2-[[5-(1,1,2,2-tetrafluoropropyl)-2-bicyclo[2.2.1]heptanyl]oxy]oxane |
|---|---|
| PubChem CID | 89136997 |
| Molecular Formula | C15H22F4O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-[[5-(1,1,2,2-tetrafluoropropyl)-2-bicyclo[2.2.1]heptanyl]oxy]oxane |
| SMILES | CC(F)(F)C(F)(F)C1CC2CC1CC2OC1CCCCO1 |
| InChI | InChI=1S/C15H22F4O2/c1-14(16,17)15(18,19)11-7-10-6-9(11)8-12(10)21-13-4-2-3-5-20-13/h9-13H,2-8H2,1H3 |
| InChIKey | CZOYHHMFHFYZIL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|