C16H12N2O5 — CID 110720625
phenyl N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]carbamate (PubChem CID 110720625) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is phenyl N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]carbamate.
| Compound Name | phenyl N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 110720625 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | phenyl N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(C2OC(=O)NC2=O)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C16H12N2O5/c19-14-13(23-16(21)18-14)10-6-8-11(9-7-10)17-15(20)22-12-4-2-1-3-5-12/h1-9,13H,(H,17,20)(H,18,19,21) |
| InChIKey | ROXBHYAJGCCVME-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |