C11H10N2O4 — CID 110720579
N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]acetamide (PubChem CID 110720579) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]acetamide.
| Compound Name | N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 110720579 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | N-[4-(2,4-dioxo-1,3-oxazolidin-5-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2OC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C11H10N2O4/c1-6(14)12-8-4-2-7(3-5-8)9-10(15)13-11(16)17-9/h2-5,9H,1H3,(H,12,14)(H,13,15,16) |
| InChIKey | HLHCDHBKZDSXAM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |