C22H22N2O6 — CID 90464818
2,4-bis(4-acetamidophenyl)cyclobutane-1,3-dicarboxylic acid (PubChem CID 90464818) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2,4-bis(4-acetamidophenyl)cyclobutane-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis(4-acetamidophenyl)cyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 90464818 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2,4-bis(4-acetamidophenyl)cyclobutane-1,3-dicarboxylic acid |
| SMILES | CC(=O)Nc1ccc(C2C(C(=O)O)C(c3ccc(NC(C)=O)cc3)C2C(=O)O)cc1 |
| InChI | InChI=1S/C22H22N2O6/c1-11(25)23-15-7-3-13(4-8-15)17-19(21(27)28)18(20(17)22(29)30)14-5-9-16(10-6-14)24-12(2)26/h3-10,17-20H,1-2H3,(H,23,25)(H,24,26)(H,27,28)(H,29,30) |
| InChIKey | XQBBKGKEOQLJFT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |