About N-phenylacetamide;2-phenyladamantane
N-phenylacetamide;2-phenyladamantane (PubChem CID 175533998) has the molecular formula C24H29NO
and a molecular weight of 347.50 g/mol. Its IUPAC name is N-phenylacetamide;2-phenyladamantane.
Molecular Properties
| Compound Name | N-phenylacetamide;2-phenyladamantane |
| PubChem CID | 175533998 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | N-phenylacetamide;2-phenyladamantane |
| SMILES | CC(=O)Nc1ccccc1.c1ccc(C2C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C16H20.C8H9NO/c1-2-4-13(5-3-1)16-14-7-11-6-12(9-14)10-15(16)8-11;1-7(10)9-8-5-3-2-4-6-8/h1-5,11-12,14-16H,6-10H2;2-6H,1H3,(H,9,10) |
| InChIKey | NWWRNZPBKDSJBZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenylacetamide;2-phenyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylacetamide;2-phenyladamantane?
The IUPAC name of N-phenylacetamide;2-phenyladamantane (CID 175533998) is N-phenylacetamide;2-phenyladamantane.
What is the SMILES notation for N-phenylacetamide;2-phenyladamantane?
The canonical SMILES for N-phenylacetamide;2-phenyladamantane is CC(=O)Nc1ccccc1.c1ccc(C2C3CC4CC(C3)CC2C4)cc1.
What is the InChIKey of N-phenylacetamide;2-phenyladamantane?
The InChIKey is NWWRNZPBKDSJBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20.C8H9NO/c1-2-4-13(5-3-1)16-14-7-11-6-12(9-14)10-15(16)8-11;1-7(10)9-8-5-3-2-4-6-8/h1-5,11-12,14-16H,6-10H2;2-6H,1H3,(H,9,10).
What are the key properties of N-phenylacetamide;2-phenyladamantane?
N-phenylacetamide;2-phenyladamantane has a molecular weight of 347.50 g/mol, XLogP of 5.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylacetamide;2-phenyladamantane is sourced from PubChem (CID 175533998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).