C19H21F3N4O2 — CID 146178030
phenyl N-[6-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 146178030) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is phenyl N-[6-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | phenyl N-[6-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 146178030 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | phenyl N-[6-[(4-methylpiperazin-1-yl)methyl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | CN1CCN(Cc2ncc(NC(=O)Oc3ccccc3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H21F3N4O2/c1-25-7-9-26(10-8-25)13-17-16(19(20,21)22)11-14(12-23-17)24-18(27)28-15-5-3-2-4-6-15/h2-6,11-12H,7-10,13H2,1H3,(H,24,27) |
| InChIKey | LIWRRPFFODEZNZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |