C17H19N3O2 — CID 169322862
phenyl N-[6-[(2R)-2-methylpyrrolidin-1-yl]-3-pyridinyl]carbamate (PubChem CID 169322862) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is phenyl N-[6-[(2R)-2-methylpyrrolidin-1-yl]-3-pyridinyl]carbamate.
| Compound Name | phenyl N-[6-[(2R)-2-methylpyrrolidin-1-yl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 169322862 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | phenyl N-[6-[(2R)-2-methylpyrrolidin-1-yl]-3-pyridinyl]carbamate |
| SMILES | C[C@@H]1CCCN1c1ccc(NC(=O)Oc2ccccc2)cn1 |
| InChI | InChI=1S/C17H19N3O2/c1-13-6-5-11-20(13)16-10-9-14(12-18-16)19-17(21)22-15-7-3-2-4-8-15/h2-4,7-10,12-13H,5-6,11H2,1H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | ZHAOMCCHWSZJNO-CYBMUJFWSA-N |
| XLogP | 3.68 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |