C17H20N4O2 — CID 170781349
phenyl N-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]carbamate (PubChem CID 170781349) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is phenyl N-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]carbamate.
| Compound Name | phenyl N-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 170781349 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | phenyl N-[6-(2-methylpiperidin-1-yl)pyridazin-3-yl]carbamate |
| SMILES | CC1CCCCN1c1ccc(NC(=O)Oc2ccccc2)nn1 |
| InChI | InChI=1S/C17H20N4O2/c1-13-7-5-6-12-21(13)16-11-10-15(19-20-16)18-17(22)23-14-8-3-2-4-9-14/h2-4,8-11,13H,5-7,12H2,1H3,(H,18,19,22) |
| InChIKey | GKJOHWJNKCXYML-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |