About N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide
N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide (PubChem CID 113046028) has the molecular formula C19H22N4O
and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide |
| PubChem CID | 113046028 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc32)nn1)C1CCCCC1 |
| InChI | InChI=1S/C19H22N4O/c24-19(15-7-2-1-3-8-15)20-17-10-11-18(22-21-17)23-13-12-14-6-4-5-9-16(14)23/h4-6,9-11,15H,1-3,7-8,12-13H2,(H,20,21,24) |
| InChIKey | BBHFOSMYIQXTNR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide?
The IUPAC name of N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide (CID 113046028) is N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide.
What is the SMILES notation for N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide?
The canonical SMILES for N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide is O=C(Nc1ccc(N2CCc3ccccc32)nn1)C1CCCCC1.
What is the InChIKey of N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide?
The InChIKey is BBHFOSMYIQXTNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O/c24-19(15-7-2-1-3-8-15)20-17-10-11-18(22-21-17)23-13-12-14-6-4-5-9-16(14)23/h4-6,9-11,15H,1-3,7-8,12-13H2,(H,20,21,24).
What are the key properties of N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide?
N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide has a molecular weight of 322.41 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2,3-dihydroindol-1-yl)pyridazin-3-yl]cyclohexanecarboxamide is sourced from PubChem (CID 113046028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).