C20H17FN4O — CID 113046140
N-[6-(3,4-dihydro-2H-quinolin-1-yl)pyridazin-3-yl]-4-fluorobenzamide (PubChem CID 113046140) has the molecular formula C20H17FN4O and a molecular weight of 348.38 g/mol. Its IUPAC name is N-[6-(3,4-dihydro-2H-quinolin-1-yl)pyridazin-3-yl]-4-fluorobenzamide.
| Compound Name | N-[6-(3,4-dihydro-2H-quinolin-1-yl)pyridazin-3-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 113046140 |
| Molecular Formula | C20H17FN4O |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[6-(3,4-dihydro-2H-quinolin-1-yl)pyridazin-3-yl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCCc3ccccc32)nn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H17FN4O/c21-16-9-7-15(8-10-16)20(26)22-18-11-12-19(24-23-18)25-13-3-5-14-4-1-2-6-17(14)25/h1-2,4,6-12H,3,5,13H2,(H,22,23,26) |
| InChIKey | GIGJJURPPKOOCD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |