C20H16FN3O — CID 113031771
N-[5-(2,3-dihydroindol-1-yl)-2-pyridinyl]-4-fluorobenzamide (PubChem CID 113031771) has the molecular formula C20H16FN3O and a molecular weight of 333.37 g/mol. Its IUPAC name is N-[5-(2,3-dihydroindol-1-yl)-2-pyridinyl]-4-fluorobenzamide.
| Compound Name | N-[5-(2,3-dihydroindol-1-yl)-2-pyridinyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 113031771 |
| Molecular Formula | C20H16FN3O |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[5-(2,3-dihydroindol-1-yl)-2-pyridinyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc32)cn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16FN3O/c21-16-7-5-15(6-8-16)20(25)23-19-10-9-17(13-22-19)24-12-11-14-3-1-2-4-18(14)24/h1-10,13H,11-12H2,(H,22,23,25) |
| InChIKey | NUKVJAKDZYRREI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |