C22H21FN4O — CID 113029474
N-[5-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridinyl]benzamide (PubChem CID 113029474) has the molecular formula C22H21FN4O and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[5-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridinyl]benzamide.
| Compound Name | N-[5-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113029474 |
| Molecular Formula | C22H21FN4O |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-[5-[4-(2-fluorophenyl)piperazin-1-yl]-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCN(c3ccccc3F)CC2)cn1)c1ccccc1 |
| InChI | InChI=1S/C22H21FN4O/c23-19-8-4-5-9-20(19)27-14-12-26(13-15-27)18-10-11-21(24-16-18)25-22(28)17-6-2-1-3-7-17/h1-11,16H,12-15H2,(H,24,25,28) |
| InChIKey | RMAHULSKWGGOEU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |