C21H17FN2O — CID 112986182
N-[4-(2,3-dihydroindol-1-yl)phenyl]-3-fluorobenzamide (PubChem CID 112986182) has the molecular formula C21H17FN2O and a molecular weight of 332.38 g/mol. Its IUPAC name is N-[4-(2,3-dihydroindol-1-yl)phenyl]-3-fluorobenzamide.
| Compound Name | N-[4-(2,3-dihydroindol-1-yl)phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 112986182 |
| Molecular Formula | C21H17FN2O |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[4-(2,3-dihydroindol-1-yl)phenyl]-3-fluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc32)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H17FN2O/c22-17-6-3-5-16(14-17)21(25)23-18-8-10-19(11-9-18)24-13-12-15-4-1-2-7-20(15)24/h1-11,14H,12-13H2,(H,23,25) |
| InChIKey | YLOBYDBREBAYOS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |