C25H24FN3O4S — CID 55731562
N-[4-(2,3-dihydroindol-1-yl)phenyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 55731562) has the molecular formula C25H24FN3O4S and a molecular weight of 481.55 g/mol. Its IUPAC name is N-[4-(2,3-dihydroindol-1-yl)phenyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[4-(2,3-dihydroindol-1-yl)phenyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55731562 |
| Molecular Formula | C25H24FN3O4S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N-[4-(2,3-dihydroindol-1-yl)phenyl]-4-fluoro-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc32)cc1)c1ccc(F)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C25H24FN3O4S/c26-22-10-5-19(17-24(22)34(31,32)28-13-15-33-16-14-28)25(30)27-20-6-8-21(9-7-20)29-12-11-18-3-1-2-4-23(18)29/h1-10,17H,11-16H2,(H,27,30) |
| InChIKey | TXQKQUFIGGFJQR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |